C27H38N2O2 — CID 90858578
(1R,2R,3aS,6aS)-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-[5-(pyridin-2-ylamino)pentylidene]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 90858578) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is (1R,2R,3aS,6aS)-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-[5-(pyridin-2-ylamino)pentylidene]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,3aS,6aS)-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-[5-(pyridin-2-ylamino)pentylidene]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 90858578 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (1R,2R,3aS,6aS)-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-[5-(pyridin-2-ylamino)pentylidene]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CC#CC[C@@H](C)[C@H](O)C=C[C@@H]1[C@H]2CC(=CCCCCNc3ccccn3)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H38N2O2/c1-3-4-10-20(2)25(30)14-13-23-24-18-21(17-22(24)19-26(23)31)11-6-5-8-15-28-27-12-7-9-16-29-27/h7,9,11-14,16,20,22-26,30-31H,5-6,8,10,15,17-19H2,1-2H3,(H,28,29)/t20-,22+,23-,24+,25-,26-/m1/s1 |
| InChIKey | BJHMIBBZRNHVAT-GFERAKHFSA-N |
| XLogP | 4.96 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|