C71H62I3O10P3 — CID 90859361
5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole;bis(5-diphenylphosphoryl-4-iodo-2,2,7-trimethyl-1,3-benzodioxole) (PubChem CID 90859361) has the molecular formula C71H62I3O10P3 and a molecular weight of 1548.90 g/mol. Its IUPAC name is 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole;bis(5-diphenylphosphoryl-4-iodo-2,2,7-trimethyl-1,3-benzodioxole).
| Compound Name | 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole;bis(5-diphenylphosphoryl-4-iodo-2,2,7-trimethyl-1,3-benzodioxole) |
|---|---|
| PubChem CID | 90859361 |
| Molecular Formula | C71H62I3O10P3 |
| Molecular Weight | 1548.90 g/mol |
| Exact Mass | 1548.07 |
| IUPAC Name | 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole;bis(5-diphenylphosphoryl-4-iodo-2,2,7-trimethyl-1,3-benzodioxole) |
| SMILES | CC1(C)Oc2c(Oc3ccccc3)cc(P(=O)(c3ccccc3)c3ccccc3)c(I)c2O1.Cc1cc(P(=O)(c2ccccc2)c2ccccc2)c(I)c2c1OC(C)(C)O2.Cc1cc(P(=O)(c2ccccc2)c2ccccc2)c(I)c2c1OC(C)(C)O2 |
| InChI | InChI=1S/C27H22IO4P.2C22H20IO3P/c1-27(2)31-25-22(30-19-12-6-3-7-13-19)18-23(24(28)26(25)32-27)33(29,20-14-8-4-9-15-20)21-16-10-5-11-17-21;2*1-15-14-18(19(23)21-20(15)25-22(2,3)26-21)27(24,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h3-18H,1-2H3;2*4-14H,1-3H3 |
| InChIKey | KZLDYHKAHJRRIP-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1548.90 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|