C12H11Cl2F3O — CID 90860249
1,3-dichloro-5-(1,1,1-trifluoro-2-methoxypent-4-en-2-yl)benzene (PubChem CID 90860249) has the molecular formula C12H11Cl2F3O and a molecular weight of 299.12 g/mol. Its IUPAC name is 1,3-dichloro-5-(1,1,1-trifluoro-2-methoxypent-4-en-2-yl)benzene.
| Compound Name | 1,3-dichloro-5-(1,1,1-trifluoro-2-methoxypent-4-en-2-yl)benzene |
|---|---|
| PubChem CID | 90860249 |
| Molecular Formula | C12H11Cl2F3O |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 1,3-dichloro-5-(1,1,1-trifluoro-2-methoxypent-4-en-2-yl)benzene |
| SMILES | C=CCC(OC)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C12H11Cl2F3O/c1-3-4-11(18-2,12(15,16)17)8-5-9(13)7-10(14)6-8/h3,5-7H,1,4H2,2H3 |
| InChIKey | GBOCOSQJCNUXDC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|