C17H20O3 — CID 90860448
3-hydroxypentadeca-1,9,14-trien-4,6-diyn-8-yl acetate (PubChem CID 90860448) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-hydroxypentadeca-1,9,14-trien-4,6-diyn-8-yl acetate.
| Compound Name | 3-hydroxypentadeca-1,9,14-trien-4,6-diyn-8-yl acetate |
|---|---|
| PubChem CID | 90860448 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-hydroxypentadeca-1,9,14-trien-4,6-diyn-8-yl acetate |
| SMILES | C=CCCCC=CC(C#CC#CC(O)C=C)OC(C)=O |
| InChI | InChI=1S/C17H20O3/c1-4-6-7-8-9-13-17(20-15(3)18)14-11-10-12-16(19)5-2/h4-5,9,13,16-17,19H,1-2,6-8H2,3H3 |
| InChIKey | HLVQUNXVXXEPER-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|