C20H32O — CID 90860608
4-(2,2,5,5-tetramethylhexan-3-yl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 90860608) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethylhexan-3-yl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-(2,2,5,5-tetramethylhexan-3-yl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 90860608 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4-(2,2,5,5-tetramethylhexan-3-yl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CC(C)(C)CC(c1ccc(O)c2c1CCCC2)C(C)(C)C |
| InChI | InChI=1S/C20H32O/c1-19(2,3)13-17(20(4,5)6)15-11-12-18(21)16-10-8-7-9-14(15)16/h11-12,17,21H,7-10,13H2,1-6H3 |
| InChIKey | JGXSESYNEFOPLA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |