About (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one
(5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one (PubChem CID 90861353) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one.
Molecular Properties
| Compound Name | (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one |
| PubChem CID | 90861353 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one |
| SMILES | C[C@]12CC=C(O1)C(=O)CC21OCCO1 |
| InChI | InChI=1S/C10H12O4/c1-9-3-2-8(14-9)7(11)6-10(9)12-4-5-13-10/h2H,3-6H2,1H3/t9-/m1/s1 |
| InChIKey | ZZIXTVIYQFXGTB-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one?
The IUPAC name of (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one (CID 90861353) is (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one.
What is the SMILES notation for (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one?
The canonical SMILES for (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one is C[C@]12CC=C(O1)C(=O)CC21OCCO1.
What is the InChIKey of (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one?
The InChIKey is ZZIXTVIYQFXGTB-SECBINFHSA-N. The full InChI is InChI=1S/C10H12O4/c1-9-3-2-8(14-9)7(11)6-10(9)12-4-5-13-10/h2H,3-6H2,1H3/t9-/m1/s1.
What are the key properties of (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one?
(5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one has a molecular weight of 196.20 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5'R)-5'-methylspiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-1(7)-ene]-2'-one is sourced from PubChem (CID 90861353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).