About (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate
(2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate (PubChem CID 90861383) has the molecular formula C20H35NO9
and a molecular weight of 433.50 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate |
| PubChem CID | 90861383 |
| Molecular Formula | C20H35NO9 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate |
| SMILES | COCCOCC(COCCCCCCC(=O)On1c(O)ccc1O)OCCOC |
| InChI | InChI=1S/C20H35NO9/c1-25-11-13-28-16-17(29-14-12-26-2)15-27-10-6-4-3-5-7-20(24)30-21-18(22)8-9-19(21)23/h8-9,17,22-23H,3-7,10-16H2,1-2H3 |
| InChIKey | GVLWZJVYIGYBAE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate (CID 90861383) is (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate is COCCOCC(COCCCCCCC(=O)On1c(O)ccc1O)OCCOC.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate?
The InChIKey is GVLWZJVYIGYBAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO9/c1-25-11-13-28-16-17(29-14-12-26-2)15-27-10-6-4-3-5-7-20(24)30-21-18(22)8-9-19(21)23/h8-9,17,22-23H,3-7,10-16H2,1-2H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate?
(2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate has a molecular weight of 433.50 g/mol, XLogP of 1.52, 19 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 7-[2,3-bis(2-methoxyethoxy)propoxy]heptanoate is sourced from PubChem (CID 90861383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).