About 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile
1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 90861504) has the molecular formula C13H6N4
and a molecular weight of 218.22 g/mol. Its IUPAC name is 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| PubChem CID | 90861504 |
| Molecular Formula | C13H6N4 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2c3ccccc3cc-2[nH]c1C#N |
| InChI | InChI=1S/C13H6N4/c14-6-11-12(7-15)17-13-9-4-2-1-3-8(9)5-10(13)16-11/h1-5,16H |
| InChIKey | QCMQSCXTZIOUAM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The IUPAC name of 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile (CID 90861504) is 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile is N#Cc1nc2c3ccccc3cc-2[nH]c1C#N.
What is the InChIKey of 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The InChIKey is QCMQSCXTZIOUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6N4/c14-6-11-12(7-15)17-13-9-4-2-1-3-8(9)5-10(13)16-11/h1-5,16H.
What are the key properties of 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile has a molecular weight of 218.22 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 90861504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).