About 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine
4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine (PubChem CID 90861782) has the molecular formula C12H11I2NO2
and a molecular weight of 455.03 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine |
| PubChem CID | 90861782 |
| Molecular Formula | C12H11I2NO2 |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine |
| SMILES | Cc1ccc(-c2c[nH]cc2C(=O)O)cc1.II |
| InChI | InChI=1S/C12H11NO2.I2/c1-8-2-4-9(5-3-8)10-6-13-7-11(10)12(14)15;1-2/h2-7,13H,1H3,(H,14,15); |
| InChIKey | DFIXAQLZYXMZSE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine?
The IUPAC name of 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine (CID 90861782) is 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine.
What is the SMILES notation for 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine?
The canonical SMILES for 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine is Cc1ccc(-c2c[nH]cc2C(=O)O)cc1.II.
What is the InChIKey of 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine?
The InChIKey is DFIXAQLZYXMZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.I2/c1-8-2-4-9(5-3-8)10-6-13-7-11(10)12(14)15;1-2/h2-7,13H,1H3,(H,14,15);.
What are the key properties of 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine?
4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine has a molecular weight of 455.03 g/mol, XLogP of 4.46, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid;molecular iodine is sourced from PubChem (CID 90861782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).