C17H37NO — CID 90862088
8-methoxy-N,3,3,5-tetramethyl-N-propylnonan-1-amine (PubChem CID 90862088) has the molecular formula C17H37NO and a molecular weight of 271.49 g/mol. Its IUPAC name is 8-methoxy-N,3,3,5-tetramethyl-N-propylnonan-1-amine.
| Compound Name | 8-methoxy-N,3,3,5-tetramethyl-N-propylnonan-1-amine |
|---|---|
| PubChem CID | 90862088 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | 8-methoxy-N,3,3,5-tetramethyl-N-propylnonan-1-amine |
| SMILES | CCCN(C)CCC(C)(C)CC(C)CCC(C)OC |
| InChI | InChI=1S/C17H37NO/c1-8-12-18(6)13-11-17(4,5)14-15(2)9-10-16(3)19-7/h15-16H,8-14H2,1-7H3 |
| InChIKey | WLKDCUFEAAUVKK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |