C29H26FN2O6+ — CID 90862135
ethyl 6-[(4-fluorophenyl)methyl]-3-(methoxymethyl)-12-oxo-10-phenylmethoxy-4-oxa-8-aza-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),2,6,8,10-pentaene-11-carboxylate (PubChem CID 90862135) has the molecular formula C29H26FN2O6+ and a molecular weight of 517.53 g/mol. Its IUPAC name is ethyl 6-[(4-fluorophenyl)methyl]-3-(methoxymethyl)-12-oxo-10-phenylmethoxy-4-oxa-8-aza-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),2,6,8,10-pentaene-11-carboxylate.
| Compound Name | ethyl 6-[(4-fluorophenyl)methyl]-3-(methoxymethyl)-12-oxo-10-phenylmethoxy-4-oxa-8-aza-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),2,6,8,10-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 90862135 |
| Molecular Formula | C29H26FN2O6+ |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | ethyl 6-[(4-fluorophenyl)methyl]-3-(methoxymethyl)-12-oxo-10-phenylmethoxy-4-oxa-8-aza-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),2,6,8,10-pentaene-11-carboxylate |
| SMILES | CCOC(=O)C1=C(OCc2ccccc2)C2=NC=C(Cc3ccc(F)cc3)C3OC(COC)=C[N+](=C23)C1=O |
| InChI | InChI=1S/C29H26FN2O6/c1-3-36-29(34)23-27(37-16-19-7-5-4-6-8-19)24-25-26(38-22(17-35-2)15-32(25)28(23)33)20(14-31-24)13-18-9-11-21(30)12-10-18/h4-12,14-15,26H,3,13,16-17H2,1-2H3/q+1 |
| InChIKey | CFMRBAGILLYTET-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|