C11H17N5O3S — CID 90862369
(2R,3R,4S,5S)-2-(6-imino-3-methyl-4,5-dihydropurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol (PubChem CID 90862369) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-imino-3-methyl-4,5-dihydropurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-imino-3-methyl-4,5-dihydropurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 90862369 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-imino-3-methyl-4,5-dihydropurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
| SMILES | [H]/N=C1\N=CN(C)C2C1N=CN2[C@@H]1O[C@H](CS)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H17N5O3S/c1-15-3-14-9(12)6-10(15)16(4-13-6)11-8(18)7(17)5(2-20)19-11/h3-8,10-12,17-18,20H,2H2,1H3/b12-9-/t5-,6?,7-,8-,10?,11-/m1/s1 |
| InChIKey | KROQWOLYQBDDLS-SPNOGBGCSA-N |
| XLogP | -1.65 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|