C28H36N2O4S4 — CID 90862374
4-hydroxy-5-[11-(4-hydroxy-6-oxo-2,3-dihydrothieno[3,2-c]pyridin-5-yl)-2,11-dimethyl-5,8-bis(sulfanylidene)dodecan-2-yl]-2,3-dihydrothieno[3,2-c]pyridin-6-one (PubChem CID 90862374) has the molecular formula C28H36N2O4S4 and a molecular weight of 592.87 g/mol. Its IUPAC name is 4-hydroxy-5-[11-(4-hydroxy-6-oxo-2,3-dihydrothieno[3,2-c]pyridin-5-yl)-2,11-dimethyl-5,8-bis(sulfanylidene)dodecan-2-yl]-2,3-dihydrothieno[3,2-c]pyridin-6-one.
| Compound Name | 4-hydroxy-5-[11-(4-hydroxy-6-oxo-2,3-dihydrothieno[3,2-c]pyridin-5-yl)-2,11-dimethyl-5,8-bis(sulfanylidene)dodecan-2-yl]-2,3-dihydrothieno[3,2-c]pyridin-6-one |
|---|---|
| PubChem CID | 90862374 |
| Molecular Formula | C28H36N2O4S4 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 4-hydroxy-5-[11-(4-hydroxy-6-oxo-2,3-dihydrothieno[3,2-c]pyridin-5-yl)-2,11-dimethyl-5,8-bis(sulfanylidene)dodecan-2-yl]-2,3-dihydrothieno[3,2-c]pyridin-6-one |
| SMILES | CC(C)(CCC(=S)CCC(=S)CCC(C)(C)n1c(O)c2c(cc1=O)SCC2)n1c(O)c2c(cc1=O)SCC2 |
| InChI | InChI=1S/C28H36N2O4S4/c1-27(2,29-23(31)15-21-19(25(29)33)9-13-37-21)11-7-17(35)5-6-18(36)8-12-28(3,4)30-24(32)16-22-20(26(30)34)10-14-38-22/h15-16,33-34H,5-14H2,1-4H3 |
| InChIKey | GZUOWLJZSUGJCW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|