C29H29N5 — CID 90863445
2,6-bis(5-phenyl-1-propan-2-ylpyrazol-3-yl)pyridine (PubChem CID 90863445) has the molecular formula C29H29N5 and a molecular weight of 447.59 g/mol. Its IUPAC name is 2,6-bis(5-phenyl-1-propan-2-ylpyrazol-3-yl)pyridine.
| Compound Name | 2,6-bis(5-phenyl-1-propan-2-ylpyrazol-3-yl)pyridine |
|---|---|
| PubChem CID | 90863445 |
| Molecular Formula | C29H29N5 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 2,6-bis(5-phenyl-1-propan-2-ylpyrazol-3-yl)pyridine |
| SMILES | CC(C)n1nc(-c2cccc(-c3cc(-c4ccccc4)n(C(C)C)n3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C29H29N5/c1-20(2)33-28(22-12-7-5-8-13-22)18-26(31-33)24-16-11-17-25(30-24)27-19-29(34(32-27)21(3)4)23-14-9-6-10-15-23/h5-21H,1-4H3 |
| InChIKey | ZEKPZFLANQOFNZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |