About 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine
5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine (PubChem CID 90863476) has the molecular formula C11H14ClNO
and a molecular weight of 211.69 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine |
| PubChem CID | 90863476 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine |
| SMILES | CC1CC(c2ccc(Cl)cc2)ON1C |
| InChI | InChI=1S/C11H14ClNO/c1-8-7-11(14-13(8)2)9-3-5-10(12)6-4-9/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | GIAGWVMLYZWEIL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine?
The IUPAC name of 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine (CID 90863476) is 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine.
What is the SMILES notation for 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine?
The canonical SMILES for 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine is CC1CC(c2ccc(Cl)cc2)ON1C.
What is the InChIKey of 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine?
The InChIKey is GIAGWVMLYZWEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO/c1-8-7-11(14-13(8)2)9-3-5-10(12)6-4-9/h3-6,8,11H,7H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine?
5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine has a molecular weight of 211.69 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidine is sourced from PubChem (CID 90863476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).