About 2-butan-2-ylthiane
2-butan-2-ylthiane (PubChem CID 90863504) has the molecular formula C9H18S
and a molecular weight of 158.31 g/mol. Its IUPAC name is 2-butan-2-ylthiane.
Molecular Properties
| Compound Name | 2-butan-2-ylthiane |
| PubChem CID | 90863504 |
| Molecular Formula | C9H18S |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-butan-2-ylthiane |
| SMILES | CCC(C)C1CCCCS1 |
| InChI | InChI=1S/C9H18S/c1-3-8(2)9-6-4-5-7-10-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | DPGHJIAEXUXCEE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-ylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylthiane?
The IUPAC name of 2-butan-2-ylthiane (CID 90863504) is 2-butan-2-ylthiane.
What is the SMILES notation for 2-butan-2-ylthiane?
The canonical SMILES for 2-butan-2-ylthiane is CCC(C)C1CCCCS1.
What is the InChIKey of 2-butan-2-ylthiane?
The InChIKey is DPGHJIAEXUXCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18S/c1-3-8(2)9-6-4-5-7-10-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-butan-2-ylthiane?
2-butan-2-ylthiane has a molecular weight of 158.31 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylthiane is sourced from PubChem (CID 90863504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).