About ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one
ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 90863879) has the molecular formula C14H24O7S
and a molecular weight of 336.41 g/mol. Its IUPAC name is ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one.
Molecular Properties
| Compound Name | ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| PubChem CID | 90863879 |
| Molecular Formula | C14H24O7S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | CC.CCOC(=O)CS(=O)(=O)O.O=C1OC2CC3CC1C2C3 |
| InChI | InChI=1S/C8H10O2.C4H8O5S.C2H6/c9-8-6-2-4-1-5(6)7(3-4)10-8;1-2-9-4(5)3-10(6,7)8;1-2/h4-7H,1-3H2;2-3H2,1H3,(H,6,7,8);1-2H3 |
| InChIKey | MMNTWYDPEKXIFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one (CID 90863879) is ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one is CC.CCOC(=O)CS(=O)(=O)O.O=C1OC2CC3CC1C2C3.
What is the InChIKey of ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is MMNTWYDPEKXIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C4H8O5S.C2H6/c9-8-6-2-4-1-5(6)7(3-4)10-8;1-2-9-4(5)3-10(6,7)8;1-2/h4-7H,1-3H2;2-3H2,1H3,(H,6,7,8);1-2H3.
What are the key properties of ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one?
ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 336.41 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethoxy-2-oxoethanesulfonic acid;4-oxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 90863879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).