C10H9N3O5 — CID 90863942
5-[3-(dimethylamino)-2,4-dioxocyclobutylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 90863942) has the molecular formula C10H9N3O5 and a molecular weight of 251.20 g/mol. Its IUPAC name is 5-[3-(dimethylamino)-2,4-dioxocyclobutylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[3-(dimethylamino)-2,4-dioxocyclobutylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90863942 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-[3-(dimethylamino)-2,4-dioxocyclobutylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN(C)C1C(=O)C(=C2C(=O)NC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C10H9N3O5/c1-13(2)5-6(14)3(7(5)15)4-8(16)11-10(18)12-9(4)17/h5H,1-2H3,(H2,11,12,16,17,18) |
| InChIKey | XXZDNLLDSIESRP-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|