C13H15N3O2 — CID 90864078
2-[(3-ethyl-1,2-oxazol-5-yl)methylamino]benzamide (PubChem CID 90864078) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[(3-ethyl-1,2-oxazol-5-yl)methylamino]benzamide.
| Compound Name | 2-[(3-ethyl-1,2-oxazol-5-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 90864078 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[(3-ethyl-1,2-oxazol-5-yl)methylamino]benzamide |
| SMILES | CCc1cc(CNc2ccccc2C(N)=O)on1 |
| InChI | InChI=1S/C13H15N3O2/c1-2-9-7-10(18-16-9)8-15-12-6-4-3-5-11(12)13(14)17/h3-7,15H,2,8H2,1H3,(H2,14,17) |
| InChIKey | JEWDFJNPNRUQMT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |