About [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate
[5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate (PubChem CID 90864676) has the molecular formula C18H25F3O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate |
| PubChem CID | 90864676 |
| Molecular Formula | C18H25F3O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OC1C2CC3C1OC(=O)C3(C(F)(F)F)C2 |
| InChI | InChI=1S/C18H25F3O4/c1-5-16(4,7-9(2)3)14(22)24-12-10-6-11-13(12)25-15(23)17(11,8-10)18(19,20)21/h9-13H,5-8H2,1-4H3 |
| InChIKey | VEQGVHFCPHENAW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The IUPAC name of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate (CID 90864676) is [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate.
What is the SMILES notation for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The canonical SMILES for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate is CCC(C)(CC(C)C)C(=O)OC1C2CC3C1OC(=O)C3(C(F)(F)F)C2.
What is the InChIKey of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
The InChIKey is VEQGVHFCPHENAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F3O4/c1-5-16(4,7-9(2)3)14(22)24-12-10-6-11-13(12)25-15(23)17(11,8-10)18(19,20)21/h9-13H,5-8H2,1-4H3.
What are the key properties of [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate?
[5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate has a molecular weight of 362.39 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-6-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-ethyl-2,4-dimethylpentanoate is sourced from PubChem (CID 90864676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).