C24H22F2O5S — CID 90864916
tert-butyl 2-[2-[4-(benzenesulfonyl)-3-fluorophenyl]-4-fluorophenoxy]acetate (PubChem CID 90864916) has the molecular formula C24H22F2O5S and a molecular weight of 460.50 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(benzenesulfonyl)-3-fluorophenyl]-4-fluorophenoxy]acetate.
| Compound Name | tert-butyl 2-[2-[4-(benzenesulfonyl)-3-fluorophenyl]-4-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 90864916 |
| Molecular Formula | C24H22F2O5S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | tert-butyl 2-[2-[4-(benzenesulfonyl)-3-fluorophenyl]-4-fluorophenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(F)cc1-c1ccc(S(=O)(=O)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H22F2O5S/c1-24(2,3)31-23(27)15-30-21-11-10-17(25)14-19(21)16-9-12-22(20(26)13-16)32(28,29)18-7-5-4-6-8-18/h4-14H,15H2,1-3H3 |
| InChIKey | SZNUOBABKISGCD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |