C40H31N3O11 — CID 90865034
[(3R,4R,5R)-4,5-dibenzoyloxy-6-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2,4-dioxopyrimidin-1-yl]oxan-3-yl] benzoate (PubChem CID 90865034) has the molecular formula C40H31N3O11 and a molecular weight of 729.70 g/mol. Its IUPAC name is [(3R,4R,5R)-4,5-dibenzoyloxy-6-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2,4-dioxopyrimidin-1-yl]oxan-3-yl] benzoate.
| Compound Name | [(3R,4R,5R)-4,5-dibenzoyloxy-6-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2,4-dioxopyrimidin-1-yl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 90865034 |
| Molecular Formula | C40H31N3O11 |
| Molecular Weight | 729.70 g/mol |
| Exact Mass | 729.20 |
| IUPAC Name | [(3R,4R,5R)-4,5-dibenzoyloxy-6-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2,4-dioxopyrimidin-1-yl]oxan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@H](OC(=O)c2ccccc2)COC(n2cc(CCN3C(=O)c4ccccc4C3=O)c(=O)[nH]c2=O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H31N3O11/c44-33-27(20-21-42-34(45)28-18-10-11-19-29(28)35(42)46)22-43(40(50)41-33)36-32(54-39(49)26-16-8-3-9-17-26)31(53-38(48)25-14-6-2-7-15-25)30(23-51-36)52-37(47)24-12-4-1-5-13-24/h1-19,22,30-32,36H,20-21,23H2,(H,41,44,50)/t30-,31-,32-,36?/m1/s1 |
| InChIKey | CNWPNQFMEOFNOV-KHNYTTGZSA-N |
| XLogP | 3.58 |
| TPSA | 180.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|