C27H37F3O8SSi — CID 90865255
(3aR,6S,7S)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran;trimethylsilyl trifluoromethanesulfonate (PubChem CID 90865255) has the molecular formula C27H37F3O8SSi and a molecular weight of 606.73 g/mol. Its IUPAC name is (3aR,6S,7S)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran;trimethylsilyl trifluoromethanesulfonate.
| Compound Name | (3aR,6S,7S)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran;trimethylsilyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90865255 |
| Molecular Formula | C27H37F3O8SSi |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | (3aR,6S,7S)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran;trimethylsilyl trifluoromethanesulfonate |
| SMILES | CC1O[C@@H]2OC(C)(C)OC2[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1.C[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H28O5.C4H9F3O3SSi/c1-16-19(24-14-17-10-6-4-7-11-17)20(25-15-18-12-8-5-9-13-18)21-22(26-16)28-23(2,3)27-21;1-12(2,3)10-11(8,9)4(5,6)7/h4-13,16,19-22H,14-15H2,1-3H3;1-3H3/t16?,19-,20-,21?,22+;/m0./s1 |
| InChIKey | OIKZOVWBDBUKRR-BGEMNCHZSA-N |
| XLogP | 5.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|