About 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine
3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine (PubChem CID 90865749) has the molecular formula C15H29N3O3
and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine.
Molecular Properties
| Compound Name | 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine |
| PubChem CID | 90865749 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine |
| SMILES | [H]/N=C/CCOCC(CC)(COCC/C=N/[H])COCC/C=N/[H] |
| InChI | InChI=1S/C15H29N3O3/c1-2-15(12-19-9-3-6-16,13-20-10-4-7-17)14-21-11-5-8-18/h6-8,16-18H,2-5,9-14H2,1H3/b16-6+,17-7+,18-8+ |
| InChIKey | ARHGBLCUOAZAIN-IEVBBQPQSA-N |
| XLogP | 2.55 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine?
The IUPAC name of 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine (CID 90865749) is 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine.
What is the SMILES notation for 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine?
The canonical SMILES for 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine is [H]/N=C/CCOCC(CC)(COCC/C=N/[H])COCC/C=N/[H].
What is the InChIKey of 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine?
The InChIKey is ARHGBLCUOAZAIN-IEVBBQPQSA-N. The full InChI is InChI=1S/C15H29N3O3/c1-2-15(12-19-9-3-6-16,13-20-10-4-7-17)14-21-11-5-8-18/h6-8,16-18H,2-5,9-14H2,1H3/b16-6+,17-7+,18-8+.
What are the key properties of 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine?
3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine has a molecular weight of 299.41 g/mol, XLogP of 2.55, 16 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-bis(3-iminopropoxymethyl)butoxy]propan-1-imine is sourced from PubChem (CID 90865749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).