C28H44F2O7 — CID 90866678
methyl 7-[(1R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 90866678) has the molecular formula C28H44F2O7 and a molecular weight of 530.65 g/mol. Its IUPAC name is methyl 7-[(1R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 90866678 |
| Molecular Formula | C28H44F2O7 |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | methyl 7-[(1R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)CC=C1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H44F2O7/c1-4-5-17-28(29,30)25(32)16-15-22-21(12-8-6-7-9-13-26(33)34-3)23(36-20(2)31)19-24(22)37-27-14-10-11-18-35-27/h15,21,23-24,27H,4-14,16-19H2,1-3H3/t21-,23+,24-,27?/m1/s1 |
| InChIKey | MRXLIZJICVDLFN-OIEXWRJMSA-N |
| XLogP | 6.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|