C20H18ClN3O3 — CID 9086679
N'-[2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetyl]-3-chlorobenzohydrazide (PubChem CID 9086679) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N'-[2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetyl]-3-chlorobenzohydrazide.
| Compound Name | N'-[2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetyl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 9086679 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N'-[2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetyl]-3-chlorobenzohydrazide |
| SMILES | CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-13(25)24-10-9-14-5-2-3-8-17(14)18(24)12-19(26)22-23-20(27)15-6-4-7-16(21)11-15/h2-11,18H,12H2,1H3,(H,22,26)(H,23,27)/t18-/m0/s1 |
| InChIKey | HXDYUJWVSBUGOH-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|