About chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate
chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate (PubChem CID 90866834) has the molecular formula C7H14ClN3O8S2
and a molecular weight of 367.79 g/mol. Its IUPAC name is chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate.
Molecular Properties
| Compound Name | chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate |
| PubChem CID | 90866834 |
| Molecular Formula | C7H14ClN3O8S2 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate |
| SMILES | COC(=O)NC(=NS(C)(=O)=O)NC(=O)OC.CS(=O)OCl |
| InChI | InChI=1S/C6H11N3O6S.CH3ClO2S/c1-14-5(10)7-4(8-6(11)15-2)9-16(3,12)13;1-5(3)4-2/h1-3H3,(H2,7,8,9,10,11);1H3 |
| InChIKey | LACKOVZZJJVTIA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate?
The IUPAC name of chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate (CID 90866834) is chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate.
What is the SMILES notation for chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate?
The canonical SMILES for chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate is COC(=O)NC(=NS(C)(=O)=O)NC(=O)OC.CS(=O)OCl.
What is the InChIKey of chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate?
The InChIKey is LACKOVZZJJVTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O6S.CH3ClO2S/c1-14-5(10)7-4(8-6(11)15-2)9-16(3,12)13;1-5(3)4-2/h1-3H3,(H2,7,8,9,10,11);1H3.
What are the key properties of chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate?
chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate has a molecular weight of 367.79 g/mol, XLogP of -0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for chloro methanesulfinate;methyl N-(N-methoxycarbonyl-N'-methylsulfonylcarbamimidoyl)carbamate is sourced from PubChem (CID 90866834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).