C26H31FN2O2S — CID 90866886
4-[[2-fluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazole-2-thione (PubChem CID 90866886) has the molecular formula C26H31FN2O2S and a molecular weight of 454.61 g/mol. Its IUPAC name is 4-[[2-fluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[2-fluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 90866886 |
| Molecular Formula | C26H31FN2O2S |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-[[2-fluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-5-hydroxy-1,3-dihydroimidazole-2-thione |
| SMILES | COc1ccc(Cc2[nH]c(=S)[nH]c2O)c(F)c1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H31FN2O2S/c1-14-11-17-18(26(4,5)10-9-25(17,2)3)13-16(14)21-20(31-6)8-7-15(22(21)27)12-19-23(30)29-24(32)28-19/h7-8,11,13,30H,9-10,12H2,1-6H3,(H2,28,29,32) |
| InChIKey | WWFQLSCXAQZQTN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|