C29H56O6Si — CID 90866933
tert-butyl (9R,12R,13S)-13-acetyloxy-9-hydroxy-12-tri(propan-2-yl)silyloxytetradec-10-enoate (PubChem CID 90866933) has the molecular formula C29H56O6Si and a molecular weight of 528.85 g/mol. Its IUPAC name is tert-butyl (9R,12R,13S)-13-acetyloxy-9-hydroxy-12-tri(propan-2-yl)silyloxytetradec-10-enoate.
| Compound Name | tert-butyl (9R,12R,13S)-13-acetyloxy-9-hydroxy-12-tri(propan-2-yl)silyloxytetradec-10-enoate |
|---|---|
| PubChem CID | 90866933 |
| Molecular Formula | C29H56O6Si |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | tert-butyl (9R,12R,13S)-13-acetyloxy-9-hydroxy-12-tri(propan-2-yl)silyloxytetradec-10-enoate |
| SMILES | CC(=O)O[C@@H](C)[C@@H](C=C[C@H](O)CCCCCCCC(=O)OC(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H56O6Si/c1-21(2)36(22(3)4,23(5)6)35-27(24(7)33-25(8)30)20-19-26(31)17-15-13-12-14-16-18-28(32)34-29(9,10)11/h19-24,26-27,31H,12-18H2,1-11H3/t24-,26+,27+/m0/s1 |
| InChIKey | NKUJYNVHHLXCFO-WYMJOSIYSA-N |
| XLogP | 7.49 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|