C17H36 — CID 90867354
1,4-dipropylcyclohexane;pentane (PubChem CID 90867354) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 1,4-dipropylcyclohexane;pentane.
| Compound Name | 1,4-dipropylcyclohexane;pentane |
|---|---|
| PubChem CID | 90867354 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 1,4-dipropylcyclohexane;pentane |
| SMILES | CCCC1CCC(CCC)CC1.CCCCC |
| InChI | InChI=1S/C12H24.C5H12/c1-3-5-11-7-9-12(6-4-2)10-8-11;1-3-5-4-2/h11-12H,3-10H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | WZPBGVAYJYDTDS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |