C20H20F4N6O3 — CID 90868078
4-[5-[(3-amino-4,4,4-trifluoro-2-oxobutanoyl)amino]-2-pyridinyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 90868078) has the molecular formula C20H20F4N6O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is 4-[5-[(3-amino-4,4,4-trifluoro-2-oxobutanoyl)amino]-2-pyridinyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[5-[(3-amino-4,4,4-trifluoro-2-oxobutanoyl)amino]-2-pyridinyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90868078 |
| Molecular Formula | C20H20F4N6O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 4-[5-[(3-amino-4,4,4-trifluoro-2-oxobutanoyl)amino]-2-pyridinyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | NC(C(=O)C(=O)Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)nc1)C(F)(F)F |
| InChI | InChI=1S/C20H20F4N6O3/c21-13-3-1-2-4-14(13)28-19(33)30-9-7-29(8-10-30)15-6-5-12(11-26-15)27-18(32)16(31)17(25)20(22,23)24/h1-6,11,17H,7-10,25H2,(H,27,32)(H,28,33) |
| InChIKey | CKECMXJYMYPLRZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|