C16H12F3NO3 — CID 90868094
3,5-dihydroxy-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one (PubChem CID 90868094) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is 3,5-dihydroxy-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one.
| Compound Name | 3,5-dihydroxy-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
|---|---|
| PubChem CID | 90868094 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3,5-dihydroxy-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
| SMILES | O=C1CC2CCC1c1c2c(O)n(-c2cc(F)c(F)cc2F)c1O |
| InChI | InChI=1S/C16H12F3NO3/c17-8-4-10(19)11(5-9(8)18)20-15(22)13-6-1-2-7(12(21)3-6)14(13)16(20)23/h4-7,22-23H,1-3H2 |
| InChIKey | CYUHKEFJINQNOE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|