C26H46 — CID 90868296
2-(3,3,4,4,6,6,7-heptamethyloct-1-enyl)-5-(2-methylbutan-2-yl)cyclohexa-1,3-diene (PubChem CID 90868296) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 2-(3,3,4,4,6,6,7-heptamethyloct-1-enyl)-5-(2-methylbutan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 2-(3,3,4,4,6,6,7-heptamethyloct-1-enyl)-5-(2-methylbutan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90868296 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 2-(3,3,4,4,6,6,7-heptamethyloct-1-enyl)-5-(2-methylbutan-2-yl)cyclohexa-1,3-diene |
| SMILES | CCC(C)(C)C1C=CC(C=CC(C)(C)C(C)(C)CC(C)(C)C(C)C)=CC1 |
| InChI | InChI=1S/C26H46/c1-12-23(4,5)22-15-13-21(14-16-22)17-18-25(8,9)26(10,11)19-24(6,7)20(2)3/h13-15,17-18,20,22H,12,16,19H2,1-11H3 |
| InChIKey | HBFKEACIVHHYDB-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |