C27H30F2N4O4S — CID 90868828
N-[7-[1-[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-2,2-difluoroethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide (PubChem CID 90868828) has the molecular formula C27H30F2N4O4S and a molecular weight of 544.62 g/mol. Its IUPAC name is N-[7-[1-[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-2,2-difluoroethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide.
| Compound Name | N-[7-[1-[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-2,2-difluoroethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90868828 |
| Molecular Formula | C27H30F2N4O4S |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | N-[7-[1-[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-2,2-difluoroethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide |
| SMILES | COc1ccc(CN(C)c2ccc(C(C(F)F)C3CCCc4nc(NC(C)=O)sc4C3=O)cn2)c(OC)c1 |
| InChI | InChI=1S/C27H30F2N4O4S/c1-15(34)31-27-32-20-7-5-6-19(24(35)25(20)38-27)23(26(28)29)16-9-11-22(30-13-16)33(2)14-17-8-10-18(36-3)12-21(17)37-4/h8-13,19,23,26H,5-7,14H2,1-4H3,(H,31,32,34) |
| InChIKey | CVEKRHUELAALOC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |