About [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate
[2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate (PubChem CID 90869255) has the molecular formula C22H40N2O3
and a molecular weight of 380.57 g/mol. Its IUPAC name is [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate.
Molecular Properties
| Compound Name | [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate |
| PubChem CID | 90869255 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate |
| SMILES | CCC1(CC)CCC(CN)(CC(=O)OC(=O)CC2(CN)CCC(C)(C)C2)C1 |
| InChI | InChI=1S/C22H40N2O3/c1-5-20(6-2)9-10-22(14-20,16-24)12-18(26)27-17(25)11-21(15-23)8-7-19(3,4)13-21/h5-16,23-24H2,1-4H3 |
| InChIKey | PJBUJBGETFEKOK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate?
The IUPAC name of [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate (CID 90869255) is [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate.
What is the SMILES notation for [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate?
The canonical SMILES for [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate is CCC1(CC)CCC(CN)(CC(=O)OC(=O)CC2(CN)CCC(C)(C)C2)C1.
What is the InChIKey of [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate?
The InChIKey is PJBUJBGETFEKOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40N2O3/c1-5-20(6-2)9-10-22(14-20,16-24)12-18(26)27-17(25)11-21(15-23)8-7-19(3,4)13-21/h5-16,23-24H2,1-4H3.
What are the key properties of [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate?
[2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate has a molecular weight of 380.57 g/mol, XLogP of 3.93, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(aminomethyl)-3,3-diethylcyclopentyl]acetyl] 2-[1-(aminomethyl)-3,3-dimethylcyclopentyl]acetate is sourced from PubChem (CID 90869255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).