About 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium
2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium (PubChem CID 90869649) has the molecular formula C14H18N+
and a molecular weight of 200.30 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium.
Molecular Properties
| Compound Name | 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium |
| PubChem CID | 90869649 |
| Molecular Formula | C14H18N+ |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium |
| SMILES | C=CC[N+]1(CC=C)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18N/c1-3-9-15(10-4-2)11-13-7-5-6-8-14(13)12-15/h3-8H,1-2,9-12H2/q+1 |
| InChIKey | WLZLAPKCESAQAT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium?
The IUPAC name of 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium (CID 90869649) is 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium.
What is the SMILES notation for 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium?
The canonical SMILES for 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium is C=CC[N+]1(CC=C)Cc2ccccc2C1.
What is the InChIKey of 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium?
The InChIKey is WLZLAPKCESAQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N/c1-3-9-15(10-4-2)11-13-7-5-6-8-14(13)12-15/h3-8H,1-2,9-12H2/q+1.
What are the key properties of 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium?
2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium has a molecular weight of 200.30 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enyl)-1,3-dihydroisoindol-2-ium is sourced from PubChem (CID 90869649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).