About (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride
(E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride (PubChem CID 90869664) has the molecular formula C6H9Cl2N
and a molecular weight of 166.05 g/mol. Its IUPAC name is (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride.
Molecular Properties
| Compound Name | (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride |
| PubChem CID | 90869664 |
| Molecular Formula | C6H9Cl2N |
| Molecular Weight | 166.05 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride |
| SMILES | C/N=C(Cl)/C(C)=C(\C)Cl |
| InChI | InChI=1S/C6H9Cl2N/c1-4(5(2)7)6(8)9-3/h1-3H3/b5-4+,9-6- |
| InChIKey | BKOKOOOMBXMDLG-WEHQGULRSA-N |
| XLogP | 2.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride?
The IUPAC name of (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride (CID 90869664) is (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride.
What is the SMILES notation for (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride?
The canonical SMILES for (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride is C/N=C(Cl)/C(C)=C(\C)Cl.
What is the InChIKey of (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride?
The InChIKey is BKOKOOOMBXMDLG-WEHQGULRSA-N. The full InChI is InChI=1S/C6H9Cl2N/c1-4(5(2)7)6(8)9-3/h1-3H3/b5-4+,9-6-.
What are the key properties of (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride?
(E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride has a molecular weight of 166.05 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-chloro-N,2-dimethylbut-2-enimidoyl chloride is sourced from PubChem (CID 90869664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).