C60H82N10O8 — CID 90869807
(6aR,9R,10aR)-N-(ethylcarbamoyl)-N-[3-(5-oxohexanoylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 90869807) has the molecular formula C60H82N10O8 and a molecular weight of 1071.38 g/mol. Its IUPAC name is (6aR,9R,10aR)-N-(ethylcarbamoyl)-N-[3-(5-oxohexanoylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R,10aR)-N-(ethylcarbamoyl)-N-[3-(5-oxohexanoylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 90869807 |
| Molecular Formula | C60H82N10O8 |
| Molecular Weight | 1071.38 g/mol |
| Exact Mass | 1070.63 |
| IUPAC Name | (6aR,9R,10aR)-N-(ethylcarbamoyl)-N-[3-(5-oxohexanoylamino)propyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)N(CCCNC(=O)CCCC(C)=O)C(=O)NCC)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21.C=CCN1C[C@H](C(=O)N(CCCNC(=O)CCCC(C)=O)C(=O)NCC)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/2C30H41N5O4/c2*1-4-14-34-19-22(16-24-23-10-7-11-25-28(23)21(18-33-25)17-26(24)34)29(38)35(30(39)31-5-2)15-8-13-32-27(37)12-6-9-20(3)36/h2*4,7,10-11,18,22,24,26,33H,1,5-6,8-9,12-17,19H2,2-3H3,(H,31,39)(H,32,37)/t2*22-,24-,26-/m11/s1 |
| InChIKey | CZTPAIFOYGGGMW-QXYCOKHUSA-N |
| XLogP | 7.02 |
| TPSA | 229.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.38 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|