About hept-4-en-3-imine
hept-4-en-3-imine (PubChem CID 90869811) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is hept-4-en-3-imine.
Molecular Properties
| Compound Name | hept-4-en-3-imine |
| PubChem CID | 90869811 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | hept-4-en-3-imine |
| SMILES | [H]/N=C(/C=CCC)CC |
| InChI | InChI=1S/C7H13N/c1-3-5-6-7(8)4-2/h5-6,8H,3-4H2,1-2H3/b6-5?,8-7+ |
| InChIKey | HZUKJMNDSLTTDZ-GCSGCOTJSA-N |
| XLogP | 2.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze hept-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-4-en-3-imine?
The IUPAC name of hept-4-en-3-imine (CID 90869811) is hept-4-en-3-imine.
What is the SMILES notation for hept-4-en-3-imine?
The canonical SMILES for hept-4-en-3-imine is [H]/N=C(/C=CCC)CC.
What is the InChIKey of hept-4-en-3-imine?
The InChIKey is HZUKJMNDSLTTDZ-GCSGCOTJSA-N. The full InChI is InChI=1S/C7H13N/c1-3-5-6-7(8)4-2/h5-6,8H,3-4H2,1-2H3/b6-5?,8-7+.
What are the key properties of hept-4-en-3-imine?
hept-4-en-3-imine has a molecular weight of 111.19 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-4-en-3-imine is sourced from PubChem (CID 90869811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).