C23H22F5N3O2 — CID 90870002
4-[[2-(cyclobutylmethoxy)-5-(trifluoromethyl)phenyl]methylimino]-N-(2,6-difluorophenyl)-2-iminobutanamide (PubChem CID 90870002) has the molecular formula C23H22F5N3O2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 4-[[2-(cyclobutylmethoxy)-5-(trifluoromethyl)phenyl]methylimino]-N-(2,6-difluorophenyl)-2-iminobutanamide.
| Compound Name | 4-[[2-(cyclobutylmethoxy)-5-(trifluoromethyl)phenyl]methylimino]-N-(2,6-difluorophenyl)-2-iminobutanamide |
|---|---|
| PubChem CID | 90870002 |
| Molecular Formula | C23H22F5N3O2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[[2-(cyclobutylmethoxy)-5-(trifluoromethyl)phenyl]methylimino]-N-(2,6-difluorophenyl)-2-iminobutanamide |
| SMILES | [H]/N=C(/C/C=N/Cc1cc(C(F)(F)F)ccc1OCC1CCC1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C23H22F5N3O2/c24-17-5-2-6-18(25)21(17)31-22(32)19(29)9-10-30-12-15-11-16(23(26,27)28)7-8-20(15)33-13-14-3-1-4-14/h2,5-8,10-11,14,29H,1,3-4,9,12-13H2,(H,31,32)/b29-19-,30-10+ |
| InChIKey | LQOTUPGMUAAISG-BHLSPANMSA-N |
| XLogP | 5.78 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|