C19H21ClN2O4S — CID 9087034
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone (PubChem CID 9087034) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 9087034 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone |
| SMILES | COc1ccc(Cl)cc1CC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-26-18-8-7-16(20)13-15(18)14-19(23)21-9-11-22(12-10-21)27(24,25)17-5-3-2-4-6-17/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | MRHABMJBJGDUQQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |