C17H13F6NO4 — CID 90870517
(1R,7S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10,10-tetrol (PubChem CID 90870517) has the molecular formula C17H13F6NO4 and a molecular weight of 409.28 g/mol. Its IUPAC name is (1R,7S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10,10-tetrol.
| Compound Name | (1R,7S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10,10-tetrol |
|---|---|
| PubChem CID | 90870517 |
| Molecular Formula | C17H13F6NO4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (1R,7S)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10,10-tetrol |
| SMILES | Oc1c2c(c(O)n1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CC[C@H]2C1(O)O |
| InChI | InChI=1S/C17H13F6NO4/c18-16(19,20)6-3-7(17(21,22)23)5-8(4-6)24-13(25)11-9-1-2-10(15(9,27)28)12(11)14(24)26/h3-5,9-10,25-28H,1-2H2/t9-,10+ |
| InChIKey | MWDYIOFEKSAACS-AOOOYVTPSA-N |
| XLogP | 3.58 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|