C17H13F3N2O5 — CID 90870916
3,5-dihydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one (PubChem CID 90870916) has the molecular formula C17H13F3N2O5 and a molecular weight of 382.29 g/mol. Its IUPAC name is 3,5-dihydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one.
| Compound Name | 3,5-dihydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
|---|---|
| PubChem CID | 90870916 |
| Molecular Formula | C17H13F3N2O5 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3,5-dihydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
| SMILES | O=C1CC2CCC1c1c2c(O)n(-c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H13F3N2O5/c18-17(19,20)10-6-8(2-4-11(10)22(26)27)21-15(24)13-7-1-3-9(12(23)5-7)14(13)16(21)25/h2,4,6-7,9,24-25H,1,3,5H2 |
| InChIKey | KKAZQNIHWBRKDQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|