About ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine
ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine (PubChem CID 90870918) has the molecular formula C19H26S
and a molecular weight of 286.48 g/mol. Its IUPAC name is ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine.
Molecular Properties
| Compound Name | ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine |
| PubChem CID | 90870918 |
| Molecular Formula | C19H26S |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine |
| SMILES | CC.CC.CC1Cc2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C15H14S.2C2H6/c1-11-10-12-6-2-4-8-14(12)16-15-9-5-3-7-13(11)15;2*1-2/h2-9,11H,10H2,1H3;2*1-2H3 |
| InChIKey | PSCXYYCBUBWGAQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine?
The IUPAC name of ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine (CID 90870918) is ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine.
What is the SMILES notation for ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine?
The canonical SMILES for ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine is CC.CC.CC1Cc2ccccc2Sc2ccccc21.
What is the InChIKey of ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine?
The InChIKey is PSCXYYCBUBWGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14S.2C2H6/c1-11-10-12-6-2-4-8-14(12)16-15-9-5-3-7-13(11)15;2*1-2/h2-9,11H,10H2,1H3;2*1-2H3.
What are the key properties of ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine?
ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine has a molecular weight of 286.48 g/mol, XLogP of 6.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-5,6-dihydrobenzo[b][1]benzothiepine is sourced from PubChem (CID 90870918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).