C7H9Br2N — CID 90871570
2,5-dibromopyridine;ethane (PubChem CID 90871570) has the molecular formula C7H9Br2N and a molecular weight of 266.96 g/mol. Its IUPAC name is 2,5-dibromopyridine;ethane.
| Compound Name | 2,5-dibromopyridine;ethane |
|---|---|
| PubChem CID | 90871570 |
| Molecular Formula | C7H9Br2N |
| Molecular Weight | 266.96 g/mol |
| Exact Mass | 264.91 |
| IUPAC Name | 2,5-dibromopyridine;ethane |
| SMILES | Brc1ccc(Br)nc1.CC |
| InChI | InChI=1S/C5H3Br2N.C2H6/c6-4-1-2-5(7)8-3-4;1-2/h1-3H;1-2H3 |
| InChIKey | PTBSJXOGYBIEKU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|