C16H30O6P2 — CID 90872220
(4,8,12-trimethyl-1-phosphonotrideca-1,7,11-trienyl)phosphonic acid (PubChem CID 90872220) has the molecular formula C16H30O6P2 and a molecular weight of 380.36 g/mol. Its IUPAC name is (4,8,12-trimethyl-1-phosphonotrideca-1,7,11-trienyl)phosphonic acid.
| Compound Name | (4,8,12-trimethyl-1-phosphonotrideca-1,7,11-trienyl)phosphonic acid |
|---|---|
| PubChem CID | 90872220 |
| Molecular Formula | C16H30O6P2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (4,8,12-trimethyl-1-phosphonotrideca-1,7,11-trienyl)phosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)CC=C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C16H30O6P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16(23(17,18)19)24(20,21)22/h7,9,12,15H,5-6,8,10-11H2,1-4H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | GCIMOAWUDYGORG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|