C16H29F2NO — CID 90872289
4,4-difluoro-N-(3,3,4-trimethylhexyl)cyclohexane-1-carboxamide (PubChem CID 90872289) has the molecular formula C16H29F2NO and a molecular weight of 289.41 g/mol. Its IUPAC name is 4,4-difluoro-N-(3,3,4-trimethylhexyl)cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-(3,3,4-trimethylhexyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90872289 |
| Molecular Formula | C16H29F2NO |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4,4-difluoro-N-(3,3,4-trimethylhexyl)cyclohexane-1-carboxamide |
| SMILES | CCC(C)C(C)(C)CCNC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H29F2NO/c1-5-12(2)15(3,4)10-11-19-14(20)13-6-8-16(17,18)9-7-13/h12-13H,5-11H2,1-4H3,(H,19,20) |
| InChIKey | RVWNIRPCQCALKR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |