C20H21N3O5 — CID 9087269
3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-hydroxy-4-methylphenyl)propanamide (PubChem CID 9087269) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-hydroxy-4-methylphenyl)propanamide.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 9087269 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
| SMILES | COc1ccc(-c2noc(CCC(=O)Nc3ccc(C)cc3O)n2)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-12-4-6-14(15(24)10-12)21-18(25)8-9-19-22-20(23-28-19)13-5-7-16(26-2)17(11-13)27-3/h4-7,10-11,24H,8-9H2,1-3H3,(H,21,25) |
| InChIKey | DFVBBVXWHZNTSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|