C29H24FN9O7 — CID 90872733
4-[[[7-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-2-carbamoyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonyl]amino]methyl]-2-methylbenzoic acid (PubChem CID 90872733) has the molecular formula C29H24FN9O7 and a molecular weight of 629.57 g/mol. Its IUPAC name is 4-[[[7-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-2-carbamoyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonyl]amino]methyl]-2-methylbenzoic acid.
| Compound Name | 4-[[[7-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-2-carbamoyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonyl]amino]methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 90872733 |
| Molecular Formula | C29H24FN9O7 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | 4-[[[7-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-2-carbamoyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carbonyl]amino]methyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)NCc3ccc(F)c(CNc4c(N)c(=O)c4=O)c3)n3nc(C(N)=O)nc3n2)ccc1C(=O)O |
| InChI | InChI=1S/C29H24FN9O7/c1-12-6-13(2-4-16(12)28(45)46)9-34-26(43)18-8-19(39-29(36-18)37-25(38-39)24(32)42)27(44)35-10-14-3-5-17(30)15(7-14)11-33-21-20(31)22(40)23(21)41/h2-8,33H,9-11,31H2,1H3,(H2,32,42)(H,34,43)(H,35,44)(H,45,46) |
| InChIKey | IDBJZLSJCOPUGZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 253.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|