C13H30NO5PS2 — CID 90872779
[2-methyl-4-[3-(3-methylbutylsulfinyl)propylsulfinyl]butan-2-yl]oxyphosphonamidic acid (PubChem CID 90872779) has the molecular formula C13H30NO5PS2 and a molecular weight of 375.49 g/mol. Its IUPAC name is [2-methyl-4-[3-(3-methylbutylsulfinyl)propylsulfinyl]butan-2-yl]oxyphosphonamidic acid.
| Compound Name | [2-methyl-4-[3-(3-methylbutylsulfinyl)propylsulfinyl]butan-2-yl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 90872779 |
| Molecular Formula | C13H30NO5PS2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-methyl-4-[3-(3-methylbutylsulfinyl)propylsulfinyl]butan-2-yl]oxyphosphonamidic acid |
| SMILES | CC(C)CCS(=O)CCCS(=O)CCC(C)(C)OP(N)(=O)O |
| InChI | InChI=1S/C13H30NO5PS2/c1-12(2)6-10-21(17)8-5-9-22(18)11-7-13(3,4)19-20(14,15)16/h12H,5-11H2,1-4H3,(H3,14,15,16) |
| InChIKey | MOBZSHGLQBZXBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|